About 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene
4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene (PubChem CID 67854586) has the molecular formula C19H26Br2O
and a molecular weight of 430.22 g/mol. Its IUPAC name is 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene |
| PubChem CID | 67854586 |
| Molecular Formula | C19H26Br2O |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene |
| SMILES | CCCCCCCCOC1=C2CC=CC(=C(Br)Br)C2CC=C1 |
| InChI | InChI=1S/C19H26Br2O/c1-2-3-4-5-6-7-14-22-18-13-9-10-15-16(18)11-8-12-17(15)19(20)21/h8-9,12-13,15H,2-7,10-11,14H2,1H3 |
| InChIKey | HISKAMSLESIYJX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene?
The IUPAC name of 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene (CID 67854586) is 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene.
What is the SMILES notation for 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene?
The canonical SMILES for 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene is CCCCCCCCOC1=C2CC=CC(=C(Br)Br)C2CC=C1.
What is the InChIKey of 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene?
The InChIKey is HISKAMSLESIYJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26Br2O/c1-2-3-4-5-6-7-14-22-18-13-9-10-15-16(18)11-8-12-17(15)19(20)21/h8-9,12-13,15H,2-7,10-11,14H2,1H3.
What are the key properties of 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene?
4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene has a molecular weight of 430.22 g/mol, XLogP of 7.16, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibromomethylidene)-8-octoxy-4a,5-dihydro-1H-naphthalene is sourced from PubChem (CID 67854586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).