C28H24N2O5 — CID 67855361
2-[3-[(Z)-2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-(methylamino)-3-oxoprop-1-enyl]phenoxy]propanoic acid (PubChem CID 67855361) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[3-[(Z)-2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-(methylamino)-3-oxoprop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[(Z)-2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-(methylamino)-3-oxoprop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 67855361 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[3-[(Z)-2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-(methylamino)-3-oxoprop-1-enyl]phenoxy]propanoic acid |
| SMILES | CNC(=O)/C(=C\c1cccc(OC(C)C(=O)O)c1)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C28H24N2O5/c1-18(28(32)33)34-22-15-9-10-19(16-22)17-23(26(31)29-2)27-30-24(20-11-5-3-6-12-20)25(35-27)21-13-7-4-8-14-21/h3-18H,1-2H3,(H,29,31)(H,32,33)/b23-17+ |
| InChIKey | POPIMUZPMGYSSX-HAVVHWLPSA-N |
| XLogP | 5.15 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|