C8H12S — CID 67855462
2,3,3a,4,5,6-hexahydro-1-benzothiophene (PubChem CID 67855462) has the molecular formula C8H12S and a molecular weight of 140.25 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydro-1-benzothiophene.
| Compound Name | 2,3,3a,4,5,6-hexahydro-1-benzothiophene |
|---|---|
| PubChem CID | 67855462 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydro-1-benzothiophene |
| SMILES | C1=C2SCCC2CCC1 |
| InChI | InChI=1S/C8H12S/c1-2-4-8-7(3-1)5-6-9-8/h4,7H,1-3,5-6H2 |
| InChIKey | XTIZZGBHADEAMU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |