About 3-(oxan-2-yloxy)icosa-11,14-dienoic acid
3-(oxan-2-yloxy)icosa-11,14-dienoic acid (PubChem CID 67855762) has the molecular formula C25H44O4
and a molecular weight of 408.62 g/mol. Its IUPAC name is 3-(oxan-2-yloxy)icosa-11,14-dienoic acid.
Molecular Properties
| Compound Name | 3-(oxan-2-yloxy)icosa-11,14-dienoic acid |
| PubChem CID | 67855762 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 3-(oxan-2-yloxy)icosa-11,14-dienoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C25H44O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(22-24(26)27)29-25-20-17-18-21-28-25/h6-7,9-10,23,25H,2-5,8,11-22H2,1H3,(H,26,27) |
| InChIKey | OGVUDHJCBUWWQF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxan-2-yloxy)icosa-11,14-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-2-yloxy)icosa-11,14-dienoic acid?
The IUPAC name of 3-(oxan-2-yloxy)icosa-11,14-dienoic acid (CID 67855762) is 3-(oxan-2-yloxy)icosa-11,14-dienoic acid.
What is the SMILES notation for 3-(oxan-2-yloxy)icosa-11,14-dienoic acid?
The canonical SMILES for 3-(oxan-2-yloxy)icosa-11,14-dienoic acid is CCCCCC=CCC=CCCCCCCCC(CC(=O)O)OC1CCCCO1.
What is the InChIKey of 3-(oxan-2-yloxy)icosa-11,14-dienoic acid?
The InChIKey is OGVUDHJCBUWWQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H44O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(22-24(26)27)29-25-20-17-18-21-28-25/h6-7,9-10,23,25H,2-5,8,11-22H2,1H3,(H,26,27).
What are the key properties of 3-(oxan-2-yloxy)icosa-11,14-dienoic acid?
3-(oxan-2-yloxy)icosa-11,14-dienoic acid has a molecular weight of 408.62 g/mol, XLogP of 7.19, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-2-yloxy)icosa-11,14-dienoic acid is sourced from PubChem (CID 67855762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).