C25H46O4 — CID 67855810
(Z,3S)-3-(oxan-2-yloxy)icos-11-enoic acid (PubChem CID 67855810) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is (Z,3S)-3-(oxan-2-yloxy)icos-11-enoic acid.
| Compound Name | (Z,3S)-3-(oxan-2-yloxy)icos-11-enoic acid |
|---|---|
| PubChem CID | 67855810 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | (Z,3S)-3-(oxan-2-yloxy)icos-11-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC[C@@H](CC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C25H46O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(22-24(26)27)29-25-20-17-18-21-28-25/h9-10,23,25H,2-8,11-22H2,1H3,(H,26,27)/b10-9-/t23-,25?/m0/s1 |
| InChIKey | VJNVLQUQGPOOCO-GLGHYOQJSA-N |
| XLogP | 7.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|