About [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate
[2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate (PubChem CID 67855843) has the molecular formula C23H30O5
and a molecular weight of 386.49 g/mol. Its IUPAC name is [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate.
Molecular Properties
| Compound Name | [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate |
| PubChem CID | 67855843 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate |
| SMILES | CC(=O)OC1(O)C(C(C)(C)C)=CC(C(=O)c2ccccc2O)=CC1C(C)(C)C |
| InChI | InChI=1S/C23H30O5/c1-14(24)28-23(27)18(21(2,3)4)12-15(13-19(23)22(5,6)7)20(26)16-10-8-9-11-17(16)25/h8-13,18,25,27H,1-7H3 |
| InChIKey | XSWZBZXAXHRSRH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate?
The IUPAC name of [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate (CID 67855843) is [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate.
What is the SMILES notation for [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate?
The canonical SMILES for [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate is CC(=O)OC1(O)C(C(C)(C)C)=CC(C(=O)c2ccccc2O)=CC1C(C)(C)C.
What is the InChIKey of [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate?
The InChIKey is XSWZBZXAXHRSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O5/c1-14(24)28-23(27)18(21(2,3)4)12-15(13-19(23)22(5,6)7)20(26)16-10-8-9-11-17(16)25/h8-13,18,25,27H,1-7H3.
What are the key properties of [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate?
[2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate has a molecular weight of 386.49 g/mol, XLogP of 4.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-ditert-butyl-1-hydroxy-4-(2-hydroxybenzoyl)cyclohexa-2,4-dien-1-yl] acetate is sourced from PubChem (CID 67855843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).