About ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate
ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate (PubChem CID 67856098) has the molecular formula C17H16BrNO5S
and a molecular weight of 426.29 g/mol. Its IUPAC name is ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate |
| PubChem CID | 67856098 |
| Molecular Formula | C17H16BrNO5S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate |
| SMILES | CCOC(=O)C1(O)c2ccccc2S(=O)(=O)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrNO5S/c1-2-24-16(20)17(21)14-5-3-4-6-15(14)25(22,23)19(17)11-12-7-9-13(18)10-8-12/h3-10,21H,2,11H2,1H3 |
| InChIKey | FSMUDDDMXDYUJZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate?
The IUPAC name of ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate (CID 67856098) is ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate.
What is the SMILES notation for ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate?
The canonical SMILES for ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate is CCOC(=O)C1(O)c2ccccc2S(=O)(=O)N1Cc1ccc(Br)cc1.
What is the InChIKey of ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate?
The InChIKey is FSMUDDDMXDYUJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrNO5S/c1-2-24-16(20)17(21)14-5-3-4-6-15(14)25(22,23)19(17)11-12-7-9-13(18)10-8-12/h3-10,21H,2,11H2,1H3.
What are the key properties of ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate?
ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate has a molecular weight of 426.29 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-bromophenyl)methyl]-3-hydroxy-1,1-dioxo-1,2-benzothiazole-3-carboxylate is sourced from PubChem (CID 67856098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).