About guanidine;5-nitro-1,2,4-triazol-3-one
guanidine;5-nitro-1,2,4-triazol-3-one (PubChem CID 67856108) has the molecular formula C3H5N7O3
and a molecular weight of 187.12 g/mol. Its IUPAC name is guanidine;5-nitro-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | guanidine;5-nitro-1,2,4-triazol-3-one |
| PubChem CID | 67856108 |
| Molecular Formula | C3H5N7O3 |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | guanidine;5-nitro-1,2,4-triazol-3-one |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.[H]N=C(N)N |
| InChI | InChI=1S/C2N4O3.CH5N3/c7-2-3-1(4-5-2)6(8)9;2-1(3)4/h;(H5,2,3,4) |
| InChIKey | JZQNVCWIJUKFDG-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze guanidine;5-nitro-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;5-nitro-1,2,4-triazol-3-one?
The IUPAC name of guanidine;5-nitro-1,2,4-triazol-3-one (CID 67856108) is guanidine;5-nitro-1,2,4-triazol-3-one.
What is the SMILES notation for guanidine;5-nitro-1,2,4-triazol-3-one?
The canonical SMILES for guanidine;5-nitro-1,2,4-triazol-3-one is O=C1N=NC([N+](=O)[O-])=N1.[H]N=C(N)N.
What is the InChIKey of guanidine;5-nitro-1,2,4-triazol-3-one?
The InChIKey is JZQNVCWIJUKFDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N4O3.CH5N3/c7-2-3-1(4-5-2)6(8)9;2-1(3)4/h;(H5,2,3,4).
What are the key properties of guanidine;5-nitro-1,2,4-triazol-3-one?
guanidine;5-nitro-1,2,4-triazol-3-one has a molecular weight of 187.12 g/mol, XLogP of -0.96, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;5-nitro-1,2,4-triazol-3-one is sourced from PubChem (CID 67856108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).