About phenoxy N'-phenylcarbamimidothioate
phenoxy N'-phenylcarbamimidothioate (PubChem CID 67856297) has the molecular formula C13H12N2OS
and a molecular weight of 244.32 g/mol. Its IUPAC name is phenoxy N'-phenylcarbamimidothioate.
Molecular Properties
| Compound Name | phenoxy N'-phenylcarbamimidothioate |
| PubChem CID | 67856297 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | phenoxy N'-phenylcarbamimidothioate |
| SMILES | N/C(=N\c1ccccc1)SOc1ccccc1 |
| InChI | InChI=1S/C13H12N2OS/c14-13(15-11-7-3-1-4-8-11)17-16-12-9-5-2-6-10-12/h1-10H,(H2,14,15) |
| InChIKey | BKFISVMEWGXHEF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenoxy N'-phenylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxy N'-phenylcarbamimidothioate?
The IUPAC name of phenoxy N'-phenylcarbamimidothioate (CID 67856297) is phenoxy N'-phenylcarbamimidothioate.
What is the SMILES notation for phenoxy N'-phenylcarbamimidothioate?
The canonical SMILES for phenoxy N'-phenylcarbamimidothioate is N/C(=N\c1ccccc1)SOc1ccccc1.
What is the InChIKey of phenoxy N'-phenylcarbamimidothioate?
The InChIKey is BKFISVMEWGXHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2OS/c14-13(15-11-7-3-1-4-8-11)17-16-12-9-5-2-6-10-12/h1-10H,(H2,14,15).
What are the key properties of phenoxy N'-phenylcarbamimidothioate?
phenoxy N'-phenylcarbamimidothioate has a molecular weight of 244.32 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxy N'-phenylcarbamimidothioate is sourced from PubChem (CID 67856297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).