C15H27NO4Si — CID 67856319
1-(dimethylamino)-3-[3-(hydroxy-methyl-phenylsilyl)oxypropoxy]propan-2-ol (PubChem CID 67856319) has the molecular formula C15H27NO4Si and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[3-(hydroxy-methyl-phenylsilyl)oxypropoxy]propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[3-(hydroxy-methyl-phenylsilyl)oxypropoxy]propan-2-ol |
|---|---|
| PubChem CID | 67856319 |
| Molecular Formula | C15H27NO4Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-(dimethylamino)-3-[3-(hydroxy-methyl-phenylsilyl)oxypropoxy]propan-2-ol |
| SMILES | CN(C)CC(O)COCCCO[Si](C)(O)c1ccccc1 |
| InChI | InChI=1S/C15H27NO4Si/c1-16(2)12-14(17)13-19-10-7-11-20-21(3,18)15-8-5-4-6-9-15/h4-6,8-9,14,17-18H,7,10-13H2,1-3H3 |
| InChIKey | OXZJIYJBTNMILF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|