About 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene
2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene (PubChem CID 67856328) has the molecular formula C26H34O6
and a molecular weight of 442.55 g/mol. Its IUPAC name is 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene.
Molecular Properties
| Compound Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene |
| PubChem CID | 67856328 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCC(CC)(COC(=O)C(=C)C)COC(=O)C(=C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C18H26O6.C8H8/c1-8-18(9-22-15(19)12(2)3,10-23-16(20)13(4)5)11-24-17(21)14(6)7;1-2-8-6-4-3-5-7-8/h2,4,6,8-11H2,1,3,5,7H3;2-7H,1H2 |
| InChIKey | OXCDNVKCKKIIKE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene?
The IUPAC name of 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene (CID 67856328) is 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene.
What is the SMILES notation for 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene?
The canonical SMILES for 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene is C=C(C)C(=O)OCC(CC)(COC(=O)C(=C)C)COC(=O)C(=C)C.C=Cc1ccccc1.
What is the InChIKey of 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene?
The InChIKey is OXCDNVKCKKIIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O6.C8H8/c1-8-18(9-22-15(19)12(2)3,10-23-16(20)13(4)5)11-24-17(21)14(6)7;1-2-8-6-4-3-5-7-8/h2,4,6,8-11H2,1,3,5,7H3;2-7H,1H2.
What are the key properties of 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene?
2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene has a molecular weight of 442.55 g/mol, XLogP of 5.07, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;styrene is sourced from PubChem (CID 67856328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).