C35H41N7O8 — CID 67856394
6-[4-(benzhydrylamino)piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;bis((E)-but-2-enedioic acid) (PubChem CID 67856394) has the molecular formula C35H41N7O8 and a molecular weight of 687.75 g/mol. Its IUPAC name is 6-[4-(benzhydrylamino)piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;bis((E)-but-2-enedioic acid).
| Compound Name | 6-[4-(benzhydrylamino)piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 67856394 |
| Molecular Formula | C35H41N7O8 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.30 |
| IUPAC Name | 6-[4-(benzhydrylamino)piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;bis((E)-but-2-enedioic acid) |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NC(c3ccccc3)c3ccccc3)CC2)n1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C27H33N7.2C4H4O4/c1-3-17-28-25-31-26(29-18-4-2)33-27(32-25)34-19-15-23(16-20-34)30-24(21-11-7-5-8-12-21)22-13-9-6-10-14-22;2*5-3(6)1-2-4(7)8/h3-14,23-24,30H,1-2,15-20H2,(H2,28,29,31,32,33);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | CHLOVKXYLZJEMD-LVEZLNDCSA-N |
| XLogP | 3.84 |
| TPSA | 227.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|