C35H40N6O8 — CID 67856395
4-[4-(benzhydrylamino)piperidin-1-yl]-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine;bis(but-2-enedioic acid) (PubChem CID 67856395) has the molecular formula C35H40N6O8 and a molecular weight of 672.74 g/mol. Its IUPAC name is 4-[4-(benzhydrylamino)piperidin-1-yl]-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine;bis(but-2-enedioic acid).
| Compound Name | 4-[4-(benzhydrylamino)piperidin-1-yl]-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine;bis(but-2-enedioic acid) |
|---|---|
| PubChem CID | 67856395 |
| Molecular Formula | C35H40N6O8 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 4-[4-(benzhydrylamino)piperidin-1-yl]-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine;bis(but-2-enedioic acid) |
| SMILES | C=CCN(CC=C)c1ncnc(N2CCC(NC(c3ccccc3)c3ccccc3)CC2)n1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C27H32N6.2C4H4O4/c1-3-17-32(18-4-2)26-28-21-29-27(31-26)33-19-15-24(16-20-33)30-25(22-11-7-5-8-12-22)23-13-9-6-10-14-23;2*5-3(6)1-2-4(7)8/h3-14,21,24-25,30H,1-2,15-20H2;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | FISWAFFXOGFUIE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|