About 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate
4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate (PubChem CID 67857132) has the molecular formula C27H50O4
and a molecular weight of 438.69 g/mol. Its IUPAC name is 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate |
| PubChem CID | 67857132 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCOC1CCCCO1 |
| InChI | InChI=1S/C27H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-26(28)29-23-19-20-25-31-27-22-17-18-24-30-27/h9-10,27H,2-8,11-25H2,1H3/b10-9- |
| InChIKey | GEVWBVCWXTYIBD-KTKRTIGZSA-N |
| XLogP | 7.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate?
The IUPAC name of 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate (CID 67857132) is 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate.
What is the SMILES notation for 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate?
The canonical SMILES for 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCOC1CCCCO1.
What is the InChIKey of 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate?
The InChIKey is GEVWBVCWXTYIBD-KTKRTIGZSA-N. The full InChI is InChI=1S/C27H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-26(28)29-23-19-20-25-31-27-22-17-18-24-30-27/h9-10,27H,2-8,11-25H2,1H3/b10-9-.
What are the key properties of 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate?
4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate has a molecular weight of 438.69 g/mol, XLogP of 7.89, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-2-yloxy)butyl (Z)-octadec-9-enoate is sourced from PubChem (CID 67857132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).