C10H17NO — CID 67857196
6-ethoxy-6-ethylcyclohexa-2,4-dien-1-amine (PubChem CID 67857196) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 6-ethoxy-6-ethylcyclohexa-2,4-dien-1-amine.
| Compound Name | 6-ethoxy-6-ethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67857196 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 6-ethoxy-6-ethylcyclohexa-2,4-dien-1-amine |
| SMILES | CCOC1(CC)C=CC=CC1N |
| InChI | InChI=1S/C10H17NO/c1-3-10(12-4-2)8-6-5-7-9(10)11/h5-9H,3-4,11H2,1-2H3 |
| InChIKey | VSNFODKUPOWJGF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |