C13H26N4 — CID 67857329
(Z)-3,4-dimethylpent-2-ene;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 67857329) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is (Z)-3,4-dimethylpent-2-ene;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
| Compound Name | (Z)-3,4-dimethylpent-2-ene;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 67857329 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | (Z)-3,4-dimethylpent-2-ene;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| SMILES | C/C=C(/C)C(C)C.C1N2CN3CN1CN(C2)C3 |
| InChI | InChI=1S/C7H14.C6H12N4/c1-5-7(4)6(2)3;1-7-2-9-4-8(1)5-10(3-7)6-9/h5-6H,1-4H3;1-6H2/b7-5-; |
| InChIKey | ILZUNEBNCZBBHP-YJOCEBFMSA-N |
| XLogP | 1.59 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|