About 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine
5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 67857825) has the molecular formula C21H41N3
and a molecular weight of 335.58 g/mol. Its IUPAC name is 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 67857825 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC1CN=C(N)N1 |
| InChI | InChI=1S/C21H41N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-23-21(22)24-20/h9-10,20H,2-8,11-19H2,1H3,(H3,22,23,24)/b10-9- |
| InChIKey | IDRNODYNWIAJQI-KTKRTIGZSA-N |
| XLogP | 5.70 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine (CID 67857825) is 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine is CCCCCCCC/C=C\CCCCCCCCC1CN=C(N)N1.
What is the InChIKey of 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is IDRNODYNWIAJQI-KTKRTIGZSA-N. The full InChI is InChI=1S/C21H41N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-23-21(22)24-20/h9-10,20H,2-8,11-19H2,1H3,(H3,22,23,24)/b10-9-.
What are the key properties of 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine?
5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 335.58 g/mol, XLogP of 5.70, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-octadec-9-enyl]-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 67857825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).