C37H64O9 — CID 67857918
methyl 5,17-dihydroxy-19-(4-hydroxy-3-methoxycyclohexyl)-4,6-dimethoxy-2,8,10,16,18-pentamethyl-13-oxo-12-prop-2-enylnonadeca-10,18-dienoate (PubChem CID 67857918) has the molecular formula C37H64O9 and a molecular weight of 652.91 g/mol. Its IUPAC name is methyl 5,17-dihydroxy-19-(4-hydroxy-3-methoxycyclohexyl)-4,6-dimethoxy-2,8,10,16,18-pentamethyl-13-oxo-12-prop-2-enylnonadeca-10,18-dienoate.
| Compound Name | methyl 5,17-dihydroxy-19-(4-hydroxy-3-methoxycyclohexyl)-4,6-dimethoxy-2,8,10,16,18-pentamethyl-13-oxo-12-prop-2-enylnonadeca-10,18-dienoate |
|---|---|
| PubChem CID | 67857918 |
| Molecular Formula | C37H64O9 |
| Molecular Weight | 652.91 g/mol |
| Exact Mass | 652.46 |
| IUPAC Name | methyl 5,17-dihydroxy-19-(4-hydroxy-3-methoxycyclohexyl)-4,6-dimethoxy-2,8,10,16,18-pentamethyl-13-oxo-12-prop-2-enylnonadeca-10,18-dienoate |
| SMILES | C=CCC(C=C(C)CC(C)CC(OC)C(O)C(CC(C)C(=O)OC)OC)C(=O)CCC(C)C(O)C(C)=CC1CCC(O)C(OC)C1 |
| InChI | InChI=1S/C37H64O9/c1-11-12-29(30(38)15-13-25(4)35(40)26(5)20-28-14-16-31(39)32(22-28)43-7)18-23(2)17-24(3)19-33(44-8)36(41)34(45-9)21-27(6)37(42)46-10/h11,18,20,24-25,27-29,31-36,39-41H,1,12-17,19,21-22H2,2-10H3 |
| InChIKey | URYFBKDRAWLZDE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|