C20H20F2O — CID 67858071
1,2-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]benzene (PubChem CID 67858071) has the molecular formula C20H20F2O and a molecular weight of 314.38 g/mol. Its IUPAC name is 1,2-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]benzene.
| Compound Name | 1,2-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 67858071 |
| Molecular Formula | C20H20F2O |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1,2-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]benzene |
| SMILES | CCCCCCOc1ccc(C#Cc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H20F2O/c1-2-3-4-5-14-23-18-11-8-16(9-12-18)6-7-17-10-13-19(21)20(22)15-17/h8-13,15H,2-5,14H2,1H3 |
| InChIKey | AZJWDVAYYGOUIM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|