About triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine
triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine (PubChem CID 67858243) has the molecular formula C10H8N6
and a molecular weight of 212.22 g/mol. Its IUPAC name is triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine.
Molecular Properties
| Compound Name | triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine |
| PubChem CID | 67858243 |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine |
| SMILES | NCc1cc2cccnnc2c2nnnc12 |
| InChI | InChI=1S/C10H8N6/c11-5-7-4-6-2-1-3-12-13-8(6)10-9(7)14-16-15-10/h1-4H,5,11H2 |
| InChIKey | GMWFADFRWDPSSC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine?
The IUPAC name of triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine (CID 67858243) is triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine.
What is the SMILES notation for triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine?
The canonical SMILES for triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine is NCc1cc2cccnnc2c2nnnc12.
What is the InChIKey of triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine?
The InChIKey is GMWFADFRWDPSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6/c11-5-7-4-6-2-1-3-12-13-8(6)10-9(7)14-16-15-10/h1-4H,5,11H2.
What are the key properties of triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine?
triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine has a molecular weight of 212.22 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-i][1,2]benzodiazepin-4-ylmethanamine is sourced from PubChem (CID 67858243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).