About [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol
[1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol (PubChem CID 67858434) has the molecular formula C16H14FNO
and a molecular weight of 255.29 g/mol. Its IUPAC name is [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol |
| PubChem CID | 67858434 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol |
| SMILES | OCc1cc2ccccc2c(C2(F)C=CC=CC2)n1 |
| InChI | InChI=1S/C16H14FNO/c17-16(8-4-1-5-9-16)15-14-7-3-2-6-12(14)10-13(11-19)18-15/h1-8,10,19H,9,11H2 |
| InChIKey | SWYGNSFMWFTMMS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol?
The IUPAC name of [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol (CID 67858434) is [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol.
What is the SMILES notation for [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol?
The canonical SMILES for [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol is OCc1cc2ccccc2c(C2(F)C=CC=CC2)n1.
What is the InChIKey of [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol?
The InChIKey is SWYGNSFMWFTMMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO/c17-16(8-4-1-5-9-16)15-14-7-3-2-6-12(14)10-13(11-19)18-15/h1-8,10,19H,9,11H2.
What are the key properties of [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol?
[1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol has a molecular weight of 255.29 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-fluorocyclohexa-2,4-dien-1-yl)isoquinolin-3-yl]methanol is sourced from PubChem (CID 67858434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).