About 4-chloro-11H-indeno[1,2-b]quinoline
4-chloro-11H-indeno[1,2-b]quinoline (PubChem CID 67858845) has the molecular formula C16H10ClN
and a molecular weight of 251.72 g/mol. Its IUPAC name is 4-chloro-11H-indeno[1,2-b]quinoline.
Molecular Properties
| Compound Name | 4-chloro-11H-indeno[1,2-b]quinoline |
| PubChem CID | 67858845 |
| Molecular Formula | C16H10ClN |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-chloro-11H-indeno[1,2-b]quinoline |
| SMILES | Clc1cccc2c1-c1nc3ccccc3cc1C2 |
| InChI | InChI=1S/C16H10ClN/c17-13-6-3-5-11-9-12-8-10-4-1-2-7-14(10)18-16(12)15(11)13/h1-8H,9H2 |
| InChIKey | DXVGOEHMWGUFTA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-11H-indeno[1,2-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-11H-indeno[1,2-b]quinoline?
The IUPAC name of 4-chloro-11H-indeno[1,2-b]quinoline (CID 67858845) is 4-chloro-11H-indeno[1,2-b]quinoline.
What is the SMILES notation for 4-chloro-11H-indeno[1,2-b]quinoline?
The canonical SMILES for 4-chloro-11H-indeno[1,2-b]quinoline is Clc1cccc2c1-c1nc3ccccc3cc1C2.
What is the InChIKey of 4-chloro-11H-indeno[1,2-b]quinoline?
The InChIKey is DXVGOEHMWGUFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN/c17-13-6-3-5-11-9-12-8-10-4-1-2-7-14(10)18-16(12)15(11)13/h1-8H,9H2.
What are the key properties of 4-chloro-11H-indeno[1,2-b]quinoline?
4-chloro-11H-indeno[1,2-b]quinoline has a molecular weight of 251.72 g/mol, XLogP of 4.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-11H-indeno[1,2-b]quinoline is sourced from PubChem (CID 67858845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).