C13H16O4 — CID 67858897
2,2,3-trimethoxy-3,5-dihydronaphthalen-1-one (PubChem CID 67858897) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2,2,3-trimethoxy-3,5-dihydronaphthalen-1-one.
| Compound Name | 2,2,3-trimethoxy-3,5-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 67858897 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,2,3-trimethoxy-3,5-dihydronaphthalen-1-one |
| SMILES | COC1C=C2CC=CC=C2C(=O)C1(OC)OC |
| InChI | InChI=1S/C13H16O4/c1-15-11-8-9-6-4-5-7-10(9)12(14)13(11,16-2)17-3/h4-5,7-8,11H,6H2,1-3H3 |
| InChIKey | WPTYIYMRSQBCJZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|