C24H30N2O6 — CID 67859307
6-(butylcarbamoyl)-4-[3-(butylcarbamoyl)phenyl]cyclohexa-2,4-diene-1,1-dicarboxylic acid (PubChem CID 67859307) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 6-(butylcarbamoyl)-4-[3-(butylcarbamoyl)phenyl]cyclohexa-2,4-diene-1,1-dicarboxylic acid.
| Compound Name | 6-(butylcarbamoyl)-4-[3-(butylcarbamoyl)phenyl]cyclohexa-2,4-diene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 67859307 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 6-(butylcarbamoyl)-4-[3-(butylcarbamoyl)phenyl]cyclohexa-2,4-diene-1,1-dicarboxylic acid |
| SMILES | CCCCNC(=O)c1cccc(C2=CC(C(=O)NCCCC)C(C(=O)O)(C(=O)O)C=C2)c1 |
| InChI | InChI=1S/C24H30N2O6/c1-3-5-12-25-20(27)18-9-7-8-16(14-18)17-10-11-24(22(29)30,23(31)32)19(15-17)21(28)26-13-6-4-2/h7-11,14-15,19H,3-6,12-13H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | ZFGGCDYSNODWNG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|