C20H17F3N2O7S — CID 67859320
[(3S,4R)-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-3-yl] nitrate (PubChem CID 67859320) has the molecular formula C20H17F3N2O7S and a molecular weight of 486.42 g/mol. Its IUPAC name is [(3S,4R)-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-3-yl] nitrate.
| Compound Name | [(3S,4R)-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-3-yl] nitrate |
|---|---|
| PubChem CID | 67859320 |
| Molecular Formula | C20H17F3N2O7S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [(3S,4R)-2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethylsulfonyl)-3,4-dihydrochromen-3-yl] nitrate |
| SMILES | CC1(C)Oc2ccc(S(=O)(=O)C(F)(F)F)cc2[C@@H](N2Cc3ccccc3C2=O)[C@@H]1O[N+](=O)[O-] |
| InChI | InChI=1S/C20H17F3N2O7S/c1-19(2)17(32-25(27)28)16(24-10-11-5-3-4-6-13(11)18(24)26)14-9-12(7-8-15(14)31-19)33(29,30)20(21,22)23/h3-9,16-17H,10H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | NTXFOGMRYFDRDL-SJORKVTESA-N |
| XLogP | 3.43 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|