C22H19ClFN5O — CID 67859545
4-chloro-N-[5-(2-fluorophenyl)-2-hydrazinyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]benzamide (PubChem CID 67859545) has the molecular formula C22H19ClFN5O and a molecular weight of 423.88 g/mol. Its IUPAC name is 4-chloro-N-[5-(2-fluorophenyl)-2-hydrazinyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[5-(2-fluorophenyl)-2-hydrazinyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]benzamide |
|---|---|
| PubChem CID | 67859545 |
| Molecular Formula | C22H19ClFN5O |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-chloro-N-[5-(2-fluorophenyl)-2-hydrazinyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]benzamide |
| SMILES | NNC1Nc2ccccc2C(c2ccccc2F)=NC1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClFN5O/c23-14-11-9-13(10-12-14)22(30)28-20-21(29-25)26-18-8-4-2-6-16(18)19(27-20)15-5-1-3-7-17(15)24/h1-12,20-21,26,29H,25H2,(H,28,30) |
| InChIKey | ODYRFDSXQKFJPE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|