C15H25NO — CID 67859558
6-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)hexan-1-ol (PubChem CID 67859558) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)hexan-1-ol.
| Compound Name | 6-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 67859558 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 6-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)hexan-1-ol |
| SMILES | OCCCCCCN1CCCC2CC=CC=C21 |
| InChI | InChI=1S/C15H25NO/c17-13-6-2-1-5-11-16-12-7-9-14-8-3-4-10-15(14)16/h3-4,10,14,17H,1-2,5-9,11-13H2 |
| InChIKey | MQPGUNSHIWMJSC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|