About 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium
6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium (PubChem CID 67859804) has the molecular formula C19H21Cl3N4+2
and a molecular weight of 411.76 g/mol. Its IUPAC name is 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium.
Molecular Properties
| Compound Name | 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium |
| PubChem CID | 67859804 |
| Molecular Formula | C19H21Cl3N4+2 |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium |
| SMILES | CCC[n+]1c[nH]c2cc(Cl)ccc21.CC[n+]1c[nH]c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C10H11ClN2.C9H8Cl2N2/c1-2-5-13-7-12-9-6-8(11)3-4-10(9)13;1-2-13-5-12-8-3-6(10)7(11)4-9(8)13/h3-4,6-7H,2,5H2,1H3;3-5H,2H2,1H3/p+2 |
| InChIKey | QZIAIIPZLDAPBB-UHFFFAOYSA-P |
| XLogP | 5.30 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium?
The IUPAC name of 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium (CID 67859804) is 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium.
What is the SMILES notation for 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium?
The canonical SMILES for 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium is CCC[n+]1c[nH]c2cc(Cl)ccc21.CC[n+]1c[nH]c2cc(Cl)c(Cl)cc21.
What is the InChIKey of 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium?
The InChIKey is QZIAIIPZLDAPBB-UHFFFAOYSA-P. The full InChI is InChI=1S/C10H11ClN2.C9H8Cl2N2/c1-2-5-13-7-12-9-6-8(11)3-4-10(9)13;1-2-13-5-12-8-3-6(10)7(11)4-9(8)13/h3-4,6-7H,2,5H2,1H3;3-5H,2H2,1H3/p+2.
What are the key properties of 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium?
6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium has a molecular weight of 411.76 g/mol, XLogP of 5.30, 3 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-propyl-1H-benzimidazol-3-ium;5,6-dichloro-3-ethyl-1H-benzimidazol-3-ium is sourced from PubChem (CID 67859804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).