About 6-pentyl-2,5-benzodiazocine
6-pentyl-2,5-benzodiazocine (PubChem CID 67860016) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 6-pentyl-2,5-benzodiazocine.
Molecular Properties
| Compound Name | 6-pentyl-2,5-benzodiazocine |
| PubChem CID | 67860016 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 6-pentyl-2,5-benzodiazocine |
| SMILES | CCCCCC1=c2ccccc2=C/N=C\C=N/1 |
| InChI | InChI=1S/C15H18N2/c1-2-3-4-9-15-14-8-6-5-7-13(14)12-16-10-11-17-15/h5-8,10-12H,2-4,9H2,1H3/b11-10-,13-12?,15-14?,16-10-,16-12?,17-11-,17-15? |
| InChIKey | HGHDOURVVIRKRO-GKFAMMEHSA-N |
| XLogP | 2.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentyl-2,5-benzodiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentyl-2,5-benzodiazocine?
The IUPAC name of 6-pentyl-2,5-benzodiazocine (CID 67860016) is 6-pentyl-2,5-benzodiazocine.
What is the SMILES notation for 6-pentyl-2,5-benzodiazocine?
The canonical SMILES for 6-pentyl-2,5-benzodiazocine is CCCCCC1=c2ccccc2=C/N=C\C=N/1.
What is the InChIKey of 6-pentyl-2,5-benzodiazocine?
The InChIKey is HGHDOURVVIRKRO-GKFAMMEHSA-N. The full InChI is InChI=1S/C15H18N2/c1-2-3-4-9-15-14-8-6-5-7-13(14)12-16-10-11-17-15/h5-8,10-12H,2-4,9H2,1H3/b11-10-,13-12?,15-14?,16-10-,16-12?,17-11-,17-15?.
What are the key properties of 6-pentyl-2,5-benzodiazocine?
6-pentyl-2,5-benzodiazocine has a molecular weight of 226.32 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentyl-2,5-benzodiazocine is sourced from PubChem (CID 67860016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).