About 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one
3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one (PubChem CID 67860019) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one |
| PubChem CID | 67860019 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one |
| SMILES | CCCCC1NC(=O)CC=C1C(C)=O |
| InChI | InChI=1S/C11H17NO2/c1-3-4-5-10-9(8(2)13)6-7-11(14)12-10/h6,10H,3-5,7H2,1-2H3,(H,12,14) |
| InChIKey | VXTNAWCXZIVTHJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one?
The IUPAC name of 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one (CID 67860019) is 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one?
The canonical SMILES for 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one is CCCCC1NC(=O)CC=C1C(C)=O.
What is the InChIKey of 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one?
The InChIKey is VXTNAWCXZIVTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-3-4-5-10-9(8(2)13)6-7-11(14)12-10/h6,10H,3-5,7H2,1-2H3,(H,12,14).
What are the key properties of 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one?
3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one has a molecular weight of 195.26 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-butyl-2,5-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 67860019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).