C15H26N+ — CID 67860651
1-(cycloocten-1-yl)-2,3,4,5,6,7-hexahydroazocin-1-ium (PubChem CID 67860651) has the molecular formula C15H26N+ and a molecular weight of 220.38 g/mol. Its IUPAC name is 1-(cycloocten-1-yl)-2,3,4,5,6,7-hexahydroazocin-1-ium.
| Compound Name | 1-(cycloocten-1-yl)-2,3,4,5,6,7-hexahydroazocin-1-ium |
|---|---|
| PubChem CID | 67860651 |
| Molecular Formula | C15H26N+ |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | 1-(cycloocten-1-yl)-2,3,4,5,6,7-hexahydroazocin-1-ium |
| SMILES | C1=C(/[N+]2=C/CCCCCC2)CCCCCC1 |
| InChI | InChI=1S/C15H26N/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16/h11,13H,1-10,12,14H2/q+1/b15-11?,16-13+ |
| InChIKey | QEPQRSRRGSFUPW-QGWOPDBKSA-N |
| XLogP | 4.27 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|