C40H38N2O3 — CID 67860732
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-naphthalen-1-yloxynaphthalene (PubChem CID 67860732) has the molecular formula C40H38N2O3 and a molecular weight of 594.76 g/mol. Its IUPAC name is (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-naphthalen-1-yloxynaphthalene.
| Compound Name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-naphthalen-1-yloxynaphthalene |
|---|---|
| PubChem CID | 67860732 |
| Molecular Formula | C40H38N2O3 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-naphthalen-1-yloxynaphthalene |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12.c1ccc2c(Oc3cccc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C20H24N2O2.C20H14O/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-3-11-17-15(7-1)9-5-13-19(17)21-20-14-6-10-16-8-2-4-12-18(16)20/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1-14H/t13-,14-,19+,20-;/m0./s1 |
| InChIKey | VKTPGJANXLQMFY-VJAUXQICSA-N |
| XLogP | 8.96 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|