C26H39NO3 — CID 67860926
1-[(8S,9R,10S,13S,14S,17R)-9,17-dihydroxy-10,13,16-trimethyl-3-pyrrolidin-1-yl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 67860926) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is 1-[(8S,9R,10S,13S,14S,17R)-9,17-dihydroxy-10,13,16-trimethyl-3-pyrrolidin-1-yl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9R,10S,13S,14S,17R)-9,17-dihydroxy-10,13,16-trimethyl-3-pyrrolidin-1-yl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 67860926 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 1-[(8S,9R,10S,13S,14S,17R)-9,17-dihydroxy-10,13,16-trimethyl-3-pyrrolidin-1-yl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)C(C)C[C@H]2[C@@H]3CC=C4C=C(N5CCCC5)CC[C@]4(C)[C@@]3(O)CC[C@@]21C |
| InChI | InChI=1S/C26H39NO3/c1-17-15-22-21-8-7-19-16-20(27-13-5-6-14-27)9-10-23(19,3)25(21,29)12-11-24(22,4)26(17,30)18(2)28/h7,16-17,21-22,29-30H,5-6,8-15H2,1-4H3/t17?,21-,22-,23-,24-,25+,26-/m0/s1 |
| InChIKey | AZCWOMSLERROMY-HUUFGZOKSA-N |
| XLogP | 4.22 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |