C12H16O2 — CID 67861046
7-methoxy-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one (PubChem CID 67861046) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 7-methoxy-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one.
| Compound Name | 7-methoxy-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one |
|---|---|
| PubChem CID | 67861046 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 7-methoxy-3,5,6,7,8,9-hexahydrobenzo[7]annulen-4-one |
| SMILES | COC1CCC2=C(CC1)C(=O)CC=C2 |
| InChI | InChI=1S/C12H16O2/c1-14-10-6-5-9-3-2-4-12(13)11(9)8-7-10/h2-3,10H,4-8H2,1H3 |
| InChIKey | WFHGKAHWBNSMOI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |