C6H2Cl4O — CID 67861093
2,3,4,5-tetrachlorocyclohexa-2,4-dien-1-one (PubChem CID 67861093) has the molecular formula C6H2Cl4O and a molecular weight of 231.89 g/mol. Its IUPAC name is 2,3,4,5-tetrachlorocyclohexa-2,4-dien-1-one.
| Compound Name | 2,3,4,5-tetrachlorocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 67861093 |
| Molecular Formula | C6H2Cl4O |
| Molecular Weight | 231.89 g/mol |
| Exact Mass | 229.89 |
| IUPAC Name | 2,3,4,5-tetrachlorocyclohexa-2,4-dien-1-one |
| SMILES | O=C1CC(Cl)=C(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C6H2Cl4O/c7-2-1-3(11)5(9)6(10)4(2)8/h1H2 |
| InChIKey | NQGRHAQZQBZBOD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|