About 4-methyl-1,2,3,6-tetrahydropyridin-5-amine
4-methyl-1,2,3,6-tetrahydropyridin-5-amine (PubChem CID 67861468) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 4-methyl-1,2,3,6-tetrahydropyridin-5-amine.
Molecular Properties
| Compound Name | 4-methyl-1,2,3,6-tetrahydropyridin-5-amine |
| PubChem CID | 67861468 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 4-methyl-1,2,3,6-tetrahydropyridin-5-amine |
| SMILES | CC1=C(N)CNCC1 |
| InChI | InChI=1S/C6H12N2/c1-5-2-3-8-4-6(5)7/h8H,2-4,7H2,1H3 |
| InChIKey | RDRNPBLXJXNKIC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-1,2,3,6-tetrahydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
The IUPAC name of 4-methyl-1,2,3,6-tetrahydropyridin-5-amine (CID 67861468) is 4-methyl-1,2,3,6-tetrahydropyridin-5-amine.
What is the SMILES notation for 4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
The canonical SMILES for 4-methyl-1,2,3,6-tetrahydropyridin-5-amine is CC1=C(N)CNCC1.
What is the InChIKey of 4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
The InChIKey is RDRNPBLXJXNKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-5-2-3-8-4-6(5)7/h8H,2-4,7H2,1H3.
What are the key properties of 4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
4-methyl-1,2,3,6-tetrahydropyridin-5-amine has a molecular weight of 112.18 g/mol, XLogP of 0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2,3,6-tetrahydropyridin-5-amine is sourced from PubChem (CID 67861468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).