C17H19NO6 — CID 67861515
2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid (PubChem CID 67861515) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid.
| Compound Name | 2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67861515 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)OC1(c2ccc3c(c2)OCCO3)CN2CCC1CC2 |
| InChI | InChI=1S/C17H19NO6/c19-15(20)16(21)24-17(10-18-5-3-11(17)4-6-18)12-1-2-13-14(9-12)23-8-7-22-13/h1-2,9,11H,3-8,10H2,(H,19,20) |
| InChIKey | ORRXFLQIOVVKNW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|