About [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate
[1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate (PubChem CID 67862663) has the molecular formula C13H23NO5
and a molecular weight of 273.33 g/mol. Its IUPAC name is [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate.
Molecular Properties
| Compound Name | [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate |
| PubChem CID | 67862663 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate |
| SMILES | CCC(=O)OC(OC1CN2CCC1CC2)C(O)CO |
| InChI | InChI=1S/C13H23NO5/c1-2-12(17)19-13(10(16)8-15)18-11-7-14-5-3-9(11)4-6-14/h9-11,13,15-16H,2-8H2,1H3 |
| InChIKey | ADGRMBTVQKKWQI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate?
The IUPAC name of [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate (CID 67862663) is [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate.
What is the SMILES notation for [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate?
The canonical SMILES for [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate is CCC(=O)OC(OC1CN2CCC1CC2)C(O)CO.
What is the InChIKey of [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate?
The InChIKey is ADGRMBTVQKKWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO5/c1-2-12(17)19-13(10(16)8-15)18-11-7-14-5-3-9(11)4-6-14/h9-11,13,15-16H,2-8H2,1H3.
What are the key properties of [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate?
[1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate has a molecular weight of 273.33 g/mol, XLogP of -0.27, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,3-dihydroxypropyl] propanoate is sourced from PubChem (CID 67862663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).