About 8-amino-6-methoxy-3,7-dihydropurin-2-one
8-amino-6-methoxy-3,7-dihydropurin-2-one (PubChem CID 67862786) has the molecular formula C6H7N5O2
and a molecular weight of 181.16 g/mol. Its IUPAC name is 8-amino-6-methoxy-3,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 8-amino-6-methoxy-3,7-dihydropurin-2-one |
| PubChem CID | 67862786 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 8-amino-6-methoxy-3,7-dihydropurin-2-one |
| SMILES | COc1nc(=O)[nH]c2nc(N)[nH]c12 |
| InChI | InChI=1S/C6H7N5O2/c1-13-4-2-3(9-5(7)8-2)10-6(12)11-4/h1H3,(H4,7,8,9,10,11,12) |
| InChIKey | VWNOYFDURDGGDT-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-amino-6-methoxy-3,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-methoxy-3,7-dihydropurin-2-one?
The IUPAC name of 8-amino-6-methoxy-3,7-dihydropurin-2-one (CID 67862786) is 8-amino-6-methoxy-3,7-dihydropurin-2-one.
What is the SMILES notation for 8-amino-6-methoxy-3,7-dihydropurin-2-one?
The canonical SMILES for 8-amino-6-methoxy-3,7-dihydropurin-2-one is COc1nc(=O)[nH]c2nc(N)[nH]c12.
What is the InChIKey of 8-amino-6-methoxy-3,7-dihydropurin-2-one?
The InChIKey is VWNOYFDURDGGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O2/c1-13-4-2-3(9-5(7)8-2)10-6(12)11-4/h1H3,(H4,7,8,9,10,11,12).
What are the key properties of 8-amino-6-methoxy-3,7-dihydropurin-2-one?
8-amino-6-methoxy-3,7-dihydropurin-2-one has a molecular weight of 181.16 g/mol, XLogP of -0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-methoxy-3,7-dihydropurin-2-one is sourced from PubChem (CID 67862786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).