About benzene;ethyl N-octylcarbamate
benzene;ethyl N-octylcarbamate (PubChem CID 67862811) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is benzene;ethyl N-octylcarbamate.
Molecular Properties
| Compound Name | benzene;ethyl N-octylcarbamate |
| PubChem CID | 67862811 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | benzene;ethyl N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)OCC.c1ccccc1 |
| InChI | InChI=1S/C11H23NO2.C6H6/c1-3-5-6-7-8-9-10-12-11(13)14-4-2;1-2-4-6-5-3-1/h3-10H2,1-2H3,(H,12,13);1-6H |
| InChIKey | WVTWGZIFGHICQA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene;ethyl N-octylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethyl N-octylcarbamate?
The IUPAC name of benzene;ethyl N-octylcarbamate (CID 67862811) is benzene;ethyl N-octylcarbamate.
What is the SMILES notation for benzene;ethyl N-octylcarbamate?
The canonical SMILES for benzene;ethyl N-octylcarbamate is CCCCCCCCNC(=O)OCC.c1ccccc1.
What is the InChIKey of benzene;ethyl N-octylcarbamate?
The InChIKey is WVTWGZIFGHICQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2.C6H6/c1-3-5-6-7-8-9-10-12-11(13)14-4-2;1-2-4-6-5-3-1/h3-10H2,1-2H3,(H,12,13);1-6H.
What are the key properties of benzene;ethyl N-octylcarbamate?
benzene;ethyl N-octylcarbamate has a molecular weight of 279.42 g/mol, XLogP of 4.78, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethyl N-octylcarbamate is sourced from PubChem (CID 67862811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).