C16H22N2O6S — CID 67862829
2-amino-1-[(2S,3R)-3-amino-2-hydroxy-4-(4-methylsulfonylphenyl)butanoyl]cyclobutane-1-carboxylic acid (PubChem CID 67862829) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-amino-1-[(2S,3R)-3-amino-2-hydroxy-4-(4-methylsulfonylphenyl)butanoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-amino-1-[(2S,3R)-3-amino-2-hydroxy-4-(4-methylsulfonylphenyl)butanoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 67862829 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-amino-1-[(2S,3R)-3-amino-2-hydroxy-4-(4-methylsulfonylphenyl)butanoyl]cyclobutane-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(C[C@@H](N)[C@H](O)C(=O)C2(C(=O)O)CCC2N)cc1 |
| InChI | InChI=1S/C16H22N2O6S/c1-25(23,24)10-4-2-9(3-5-10)8-11(17)13(19)14(20)16(15(21)22)7-6-12(16)18/h2-5,11-13,19H,6-8,17-18H2,1H3,(H,21,22)/t11-,12?,13+,16?/m1/s1 |
| InChIKey | ZPBPGPPUTUIJIO-ZMDMRTEPSA-N |
| XLogP | -0.92 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|