C40H36N2O6 — CID 67863180
2-[6-[1,3-dioxo-4-(2-prop-2-enylphenoxy)isoindol-2-yl]hexyl]-4-(2-prop-2-enylphenoxy)isoindole-1,3-dione (PubChem CID 67863180) has the molecular formula C40H36N2O6 and a molecular weight of 640.74 g/mol. Its IUPAC name is 2-[6-[1,3-dioxo-4-(2-prop-2-enylphenoxy)isoindol-2-yl]hexyl]-4-(2-prop-2-enylphenoxy)isoindole-1,3-dione.
| Compound Name | 2-[6-[1,3-dioxo-4-(2-prop-2-enylphenoxy)isoindol-2-yl]hexyl]-4-(2-prop-2-enylphenoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 67863180 |
| Molecular Formula | C40H36N2O6 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 2-[6-[1,3-dioxo-4-(2-prop-2-enylphenoxy)isoindol-2-yl]hexyl]-4-(2-prop-2-enylphenoxy)isoindole-1,3-dione |
| SMILES | C=CCc1ccccc1Oc1cccc2c1C(=O)N(CCCCCCN1C(=O)c3cccc(Oc4ccccc4CC=C)c3C1=O)C2=O |
| InChI | InChI=1S/C40H36N2O6/c1-3-15-27-17-7-9-21-31(27)47-33-23-13-19-29-35(33)39(45)41(37(29)43)25-11-5-6-12-26-42-38(44)30-20-14-24-34(36(30)40(42)46)48-32-22-10-8-18-28(32)16-4-2/h3-4,7-10,13-14,17-24H,1-2,5-6,11-12,15-16,25-26H2 |
| InChIKey | NJCBBENTYDNPJD-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|