About 6-methoxy-3,7-dihydropurin-2-one
6-methoxy-3,7-dihydropurin-2-one (PubChem CID 67863509) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 6-methoxy-3,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-methoxy-3,7-dihydropurin-2-one |
| PubChem CID | 67863509 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 6-methoxy-3,7-dihydropurin-2-one |
| SMILES | COc1nc(=O)[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C6H6N4O2/c1-12-5-3-4(8-2-7-3)9-6(11)10-5/h2H,1H3,(H2,7,8,9,10,11) |
| InChIKey | SKOSANOVOQSHIT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-3,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3,7-dihydropurin-2-one?
The IUPAC name of 6-methoxy-3,7-dihydropurin-2-one (CID 67863509) is 6-methoxy-3,7-dihydropurin-2-one.
What is the SMILES notation for 6-methoxy-3,7-dihydropurin-2-one?
The canonical SMILES for 6-methoxy-3,7-dihydropurin-2-one is COc1nc(=O)[nH]c2nc[nH]c12.
What is the InChIKey of 6-methoxy-3,7-dihydropurin-2-one?
The InChIKey is SKOSANOVOQSHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c1-12-5-3-4(8-2-7-3)9-6(11)10-5/h2H,1H3,(H2,7,8,9,10,11).
What are the key properties of 6-methoxy-3,7-dihydropurin-2-one?
6-methoxy-3,7-dihydropurin-2-one has a molecular weight of 166.14 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3,7-dihydropurin-2-one is sourced from PubChem (CID 67863509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).