About 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol
1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol (PubChem CID 67863693) has the molecular formula C14H12O5S
and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol.
Molecular Properties
| Compound Name | 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol |
| PubChem CID | 67863693 |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol |
| SMILES | CC(O)(O)c1ccc2c(c1)S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H12O5S/c1-14(15,16)9-6-7-11-13(8-9)20(17,18)12-5-3-2-4-10(12)19-11/h2-8,15-16H,1H3 |
| InChIKey | RBUIDRKNTYBWQH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol?
The IUPAC name of 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol (CID 67863693) is 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol.
What is the SMILES notation for 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol?
The canonical SMILES for 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol is CC(O)(O)c1ccc2c(c1)S(=O)(=O)c1ccccc1O2.
What is the InChIKey of 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol?
The InChIKey is RBUIDRKNTYBWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O5S/c1-14(15,16)9-6-7-11-13(8-9)20(17,18)12-5-3-2-4-10(12)19-11/h2-8,15-16H,1H3.
What are the key properties of 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol?
1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol has a molecular weight of 292.31 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(10,10-dioxophenoxathiin-2-yl)ethane-1,1-diol is sourced from PubChem (CID 67863693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).