About 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one
1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one (PubChem CID 67863777) has the molecular formula C27H22O7
and a molecular weight of 458.47 g/mol. Its IUPAC name is 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one.
Molecular Properties
| Compound Name | 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one |
| PubChem CID | 67863777 |
| Molecular Formula | C27H22O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(O)cc1-c1ccc(O)c(O)c1)Cc1ccc(O)cc1-c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H22O7/c28-19-5-1-15(22(13-19)17-3-7-24(31)26(33)11-17)9-21(30)10-16-2-6-20(29)14-23(16)18-4-8-25(32)27(34)12-18/h1-8,11-14,28-29,31-34H,9-10H2 |
| InChIKey | UUMMRFJGRKGIDX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one?
The IUPAC name of 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one (CID 67863777) is 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one.
What is the SMILES notation for 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one?
The canonical SMILES for 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one is O=C(Cc1ccc(O)cc1-c1ccc(O)c(O)c1)Cc1ccc(O)cc1-c1ccc(O)c(O)c1.
What is the InChIKey of 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one?
The InChIKey is UUMMRFJGRKGIDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22O7/c28-19-5-1-15(22(13-19)17-3-7-24(31)26(33)11-17)9-21(30)10-16-2-6-20(29)14-23(16)18-4-8-25(32)27(34)12-18/h1-8,11-14,28-29,31-34H,9-10H2.
What are the key properties of 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one?
1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one has a molecular weight of 458.47 g/mol, XLogP of 4.61, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[2-(3,4-dihydroxyphenyl)-4-hydroxyphenyl]propan-2-one is sourced from PubChem (CID 67863777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).