C13H19NO2 — CID 67864039
4-pentyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 67864039) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-pentyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 4-pentyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67864039 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-pentyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCCCC1CC=CC2C(=O)NC(=O)C12 |
| InChI | InChI=1S/C13H19NO2/c1-2-3-4-6-9-7-5-8-10-11(9)13(16)14-12(10)15/h5,8-11H,2-4,6-7H2,1H3,(H,14,15,16) |
| InChIKey | FPIVQDVJTJCVCD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|