C12H20N2 — CID 67864185
3-pentyl-2,3,3a,7a-tetrahydro-1H-indazole (PubChem CID 67864185) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-pentyl-2,3,3a,7a-tetrahydro-1H-indazole.
| Compound Name | 3-pentyl-2,3,3a,7a-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 67864185 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-pentyl-2,3,3a,7a-tetrahydro-1H-indazole |
| SMILES | CCCCCC1NNC2C=CC=CC21 |
| InChI | InChI=1S/C12H20N2/c1-2-3-4-8-11-10-7-5-6-9-12(10)14-13-11/h5-7,9-14H,2-4,8H2,1H3 |
| InChIKey | ZYNIHOHPGJFGDE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|