About 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid
4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 67866106) has the molecular formula C15H14F2O3
and a molecular weight of 280.27 g/mol. Its IUPAC name is 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| PubChem CID | 67866106 |
| Molecular Formula | C15H14F2O3 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | Cc1ccccc1C1(OC(F)F)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C15H14F2O3/c1-10-4-2-3-5-12(10)15(20-14(16)17)8-6-11(7-9-15)13(18)19/h2-9,11,14H,1H3,(H,18,19) |
| InChIKey | VBYYLZBOAOKBDB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
The IUPAC name of 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (CID 67866106) is 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
The canonical SMILES for 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid is Cc1ccccc1C1(OC(F)F)C=CC(C(=O)O)C=C1.
What is the InChIKey of 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
The InChIKey is VBYYLZBOAOKBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2O3/c1-10-4-2-3-5-12(10)15(20-14(16)17)8-6-11(7-9-15)13(18)19/h2-9,11,14H,1H3,(H,18,19).
What are the key properties of 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid?
4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid has a molecular weight of 280.27 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid is sourced from PubChem (CID 67866106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).