About cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol
cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol (PubChem CID 67866109) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol.
Molecular Properties
| Compound Name | cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol |
| PubChem CID | 67866109 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol |
| SMILES | C1CCC(C2CCCCC2)CC1.CC(C)(CO)CO |
| InChI | InChI=1S/C12H22.C5H12O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3-6)4-7/h11-12H,1-10H2;6-7H,3-4H2,1-2H3 |
| InChIKey | LADNROPZKPCCSN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol?
The IUPAC name of cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol (CID 67866109) is cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol.
What is the SMILES notation for cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol?
The canonical SMILES for cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol is C1CCC(C2CCCCC2)CC1.CC(C)(CO)CO.
What is the InChIKey of cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol?
The InChIKey is LADNROPZKPCCSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22.C5H12O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5(2,3-6)4-7/h11-12H,1-10H2;6-7H,3-4H2,1-2H3.
What are the key properties of cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol?
cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol has a molecular weight of 270.46 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcyclohexane;2,2-dimethylpropane-1,3-diol is sourced from PubChem (CID 67866109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).