C12H15N3O4 — CID 67866156
[5-(ethylcarbamoylcarbamoyl)-2-pyridinyl]methyl acetate (PubChem CID 67866156) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is [5-(ethylcarbamoylcarbamoyl)-2-pyridinyl]methyl acetate.
| Compound Name | [5-(ethylcarbamoylcarbamoyl)-2-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 67866156 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [5-(ethylcarbamoylcarbamoyl)-2-pyridinyl]methyl acetate |
| SMILES | CCNC(=O)NC(=O)c1ccc(COC(C)=O)nc1 |
| InChI | InChI=1S/C12H15N3O4/c1-3-13-12(18)15-11(17)9-4-5-10(14-6-9)7-19-8(2)16/h4-6H,3,7H2,1-2H3,(H2,13,15,17,18) |
| InChIKey | CVZXFQQMXHVUPR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |